Name | D-Di-p-methyloxyphenyl-tartaric acid |
Synonyms | D-DATA di-p-anisoyl-d-tartaric acid Di-p-anisoyl-D-tartaric acid DI-P-ANISOYL-D-TARTARIC ACID (+)-DI-4-ANISOYL-D-TARTARIC ACID (+)-DI-P-ANISOYL-D-TARTARIC ACID Di-(+)-p-methoxy-D-tartaric acid D-Di-p-methyloxyphenyl-tartaric acid DIBENZOYL-(+)-P-METHOXY-D-TARTARIC ACID (+)-BIS(4-METHOXYBENZOYL)-D-TARTARIC ACID 2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid (2S,3S)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid |
CAS | 191605-10-4 |
EINECS | 471-150-6 |
InChI | InChI=1/C20H18O10/c1-27-13-7-3-11(4-8-13)19(25)29-15(17(21)22)16(18(23)24)30-20(26)12-5-9-14(28-2)10-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m0/s1 |
Molecular Formula | C20H18O10 |
Molar Mass | 418.35 |
Density | 1.407±0.06 g/cm3(Predicted) |
Melting Point | 193-195°C |
Boling Point | 681.6±55.0 °C(Predicted) |
Specific Rotation(α) | 167 º (c=1,EtOH) |
Flash Point | 241.638°C |
Vapor Presure | 0mmHg at 25°C |
Appearance | White powder |
pKa | 1.48±0.25(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Sensitive | Sensitive to light |
Refractive Index | 163 ° (C=1, EtOH) |
MDL | MFCD07368366 |
use | widely used in chiral resolution of amine compounds |